About N,N-dimethyl-3-[[3-methyl-5-(trifluoromethyl)phenyl]methylsulfonylamino]propan-1-amine oxide
N,N-dimethyl-3-[[3-methyl-5-(trifluoromethyl)phenyl]methylsulfonylamino]propan-1-amine oxide (PubChem CID 87159394) has the molecular formula C14H21F3N2O3S
and a molecular weight of 354.39 g/mol. Its IUPAC name is N,N-dimethyl-3-[[3-methyl-5-(trifluoromethyl)phenyl]methylsulfonylamino]propan-1-amine oxide.
Molecular Properties
| Compound Name | N,N-dimethyl-3-[[3-methyl-5-(trifluoromethyl)phenyl]methylsulfonylamino]propan-1-amine oxide |
| PubChem CID | 87159394 |
| Molecular Formula | C14H21F3N2O3S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N,N-dimethyl-3-[[3-methyl-5-(trifluoromethyl)phenyl]methylsulfonylamino]propan-1-amine oxide |
| SMILES | Cc1cc(CS(=O)(=O)NCCC[N+](C)(C)[O-])cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H21F3N2O3S/c1-11-7-12(9-13(8-11)14(15,16)17)10-23(21,22)18-5-4-6-19(2,3)20/h7-9,18H,4-6,10H2,1-3H3 |
| InChIKey | UFLGHYPCJAAGCR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-3-[[3-methyl-5-(trifluoromethyl)phenyl]methylsulfonylamino]propan-1-amine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-3-[[3-methyl-5-(trifluoromethyl)phenyl]methylsulfonylamino]propan-1-amine oxide?
The IUPAC name of N,N-dimethyl-3-[[3-methyl-5-(trifluoromethyl)phenyl]methylsulfonylamino]propan-1-amine oxide (CID 87159394) is N,N-dimethyl-3-[[3-methyl-5-(trifluoromethyl)phenyl]methylsulfonylamino]propan-1-amine oxide.
What is the SMILES notation for N,N-dimethyl-3-[[3-methyl-5-(trifluoromethyl)phenyl]methylsulfonylamino]propan-1-amine oxide?
The canonical SMILES for N,N-dimethyl-3-[[3-methyl-5-(trifluoromethyl)phenyl]methylsulfonylamino]propan-1-amine oxide is Cc1cc(CS(=O)(=O)NCCC[N+](C)(C)[O-])cc(C(F)(F)F)c1.
What is the InChIKey of N,N-dimethyl-3-[[3-methyl-5-(trifluoromethyl)phenyl]methylsulfonylamino]propan-1-amine oxide?
The InChIKey is UFLGHYPCJAAGCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21F3N2O3S/c1-11-7-12(9-13(8-11)14(15,16)17)10-23(21,22)18-5-4-6-19(2,3)20/h7-9,18H,4-6,10H2,1-3H3.
What are the key properties of N,N-dimethyl-3-[[3-methyl-5-(trifluoromethyl)phenyl]methylsulfonylamino]propan-1-amine oxide?
N,N-dimethyl-3-[[3-methyl-5-(trifluoromethyl)phenyl]methylsulfonylamino]propan-1-amine oxide has a molecular weight of 354.39 g/mol, XLogP of 2.40, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-3-[[3-methyl-5-(trifluoromethyl)phenyl]methylsulfonylamino]propan-1-amine oxide is sourced from PubChem (CID 87159394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).