About methylphosphanyl methanesulfinate
methylphosphanyl methanesulfinate (PubChem CID 87159458) has the molecular formula C2H7O2PS
and a molecular weight of 126.12 g/mol. Its IUPAC name is methylphosphanyl methanesulfinate.
Molecular Properties
| Compound Name | methylphosphanyl methanesulfinate |
| PubChem CID | 87159458 |
| Molecular Formula | C2H7O2PS |
| Molecular Weight | 126.12 g/mol |
| Exact Mass | 125.99 |
| IUPAC Name | methylphosphanyl methanesulfinate |
| SMILES | CPOS(C)=O |
| InChI | InChI=1S/C2H7O2PS/c1-5-4-6(2)3/h5H,1-2H3 |
| InChIKey | QGHHKZUDCFUNNY-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.12 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methylphosphanyl methanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylphosphanyl methanesulfinate?
The IUPAC name of methylphosphanyl methanesulfinate (CID 87159458) is methylphosphanyl methanesulfinate.
What is the SMILES notation for methylphosphanyl methanesulfinate?
The canonical SMILES for methylphosphanyl methanesulfinate is CPOS(C)=O.
What is the InChIKey of methylphosphanyl methanesulfinate?
The InChIKey is QGHHKZUDCFUNNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7O2PS/c1-5-4-6(2)3/h5H,1-2H3.
What are the key properties of methylphosphanyl methanesulfinate?
methylphosphanyl methanesulfinate has a molecular weight of 126.12 g/mol, XLogP of 0.52, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methylphosphanyl methanesulfinate is sourced from PubChem (CID 87159458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).