About 3-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pent-1-ene
3-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pent-1-ene (PubChem CID 87159514) has the molecular formula C9H15F3O
and a molecular weight of 196.21 g/mol. Its IUPAC name is 3-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pent-1-ene.
Molecular Properties
| Compound Name | 3-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pent-1-ene |
| PubChem CID | 87159514 |
| Molecular Formula | C9H15F3O |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 3-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pent-1-ene |
| SMILES | C=C(OC(C)C(F)(F)F)C(C)CC |
| InChI | InChI=1S/C9H15F3O/c1-5-6(2)7(3)13-8(4)9(10,11)12/h6,8H,3,5H2,1-2,4H3 |
| InChIKey | RDFZPGLOXRLQKP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pent-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pent-1-ene?
The IUPAC name of 3-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pent-1-ene (CID 87159514) is 3-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pent-1-ene.
What is the SMILES notation for 3-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pent-1-ene?
The canonical SMILES for 3-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pent-1-ene is C=C(OC(C)C(F)(F)F)C(C)CC.
What is the InChIKey of 3-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pent-1-ene?
The InChIKey is RDFZPGLOXRLQKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3O/c1-5-6(2)7(3)13-8(4)9(10,11)12/h6,8H,3,5H2,1-2,4H3.
What are the key properties of 3-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pent-1-ene?
3-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pent-1-ene has a molecular weight of 196.21 g/mol, XLogP of 3.51, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-(1,1,1-trifluoropropan-2-yloxy)pent-1-ene is sourced from PubChem (CID 87159514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).