C12H18ClN3O3 — CID 87159809
(1R,2S,3R,5R)-3-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 87159809) has the molecular formula C12H18ClN3O3 and a molecular weight of 287.75 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 87159809 |
| Molecular Formula | C12H18ClN3O3 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | (1R,2S,3R,5R)-3-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | Cc1nc(Cl)c(C)c(N[C@@H]2C[C@H](CO)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C12H18ClN3O3/c1-5-11(13)14-6(2)15-12(5)16-8-3-7(4-17)9(18)10(8)19/h7-10,17-19H,3-4H2,1-2H3,(H,14,15,16)/t7-,8-,9-,10+/m1/s1 |
| InChIKey | NXLUBYFDADKZTF-KYXWUPHJSA-N |
| XLogP | 0.26 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |