C13H22N4O5S — CID 87159844
[(1R,2R,3S,4R)-2,3-dihydroxy-4-[(2,5,6-trimethylpyrimidin-4-yl)amino]cyclopentyl]methyl sulfamate (PubChem CID 87159844) has the molecular formula C13H22N4O5S and a molecular weight of 346.41 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-2,3-dihydroxy-4-[(2,5,6-trimethylpyrimidin-4-yl)amino]cyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2R,3S,4R)-2,3-dihydroxy-4-[(2,5,6-trimethylpyrimidin-4-yl)amino]cyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 87159844 |
| Molecular Formula | C13H22N4O5S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | [(1R,2R,3S,4R)-2,3-dihydroxy-4-[(2,5,6-trimethylpyrimidin-4-yl)amino]cyclopentyl]methyl sulfamate |
| SMILES | Cc1nc(C)c(C)c(N[C@@H]2C[C@H](COS(N)(=O)=O)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C13H22N4O5S/c1-6-7(2)15-8(3)16-13(6)17-10-4-9(11(18)12(10)19)5-22-23(14,20)21/h9-12,18-19H,4-5H2,1-3H3,(H2,14,20,21)(H,15,16,17)/t9-,10-,11-,12+/m1/s1 |
| InChIKey | MIYVHCCLUUGZGE-KKOKHZNYSA-N |
| XLogP | -0.86 |
| TPSA | 147.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |