C41H68N2O5 — CID 87160213
bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[1-(3-tert-butyl-4-hydroxy-5-prop-1-en-2-ylphenyl)pentyl]propanedioate (PubChem CID 87160213) has the molecular formula C41H68N2O5 and a molecular weight of 669.00 g/mol. Its IUPAC name is bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[1-(3-tert-butyl-4-hydroxy-5-prop-1-en-2-ylphenyl)pentyl]propanedioate.
| Compound Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[1-(3-tert-butyl-4-hydroxy-5-prop-1-en-2-ylphenyl)pentyl]propanedioate |
|---|---|
| PubChem CID | 87160213 |
| Molecular Formula | C41H68N2O5 |
| Molecular Weight | 669.00 g/mol |
| Exact Mass | 668.51 |
| IUPAC Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[1-(3-tert-butyl-4-hydroxy-5-prop-1-en-2-ylphenyl)pentyl]propanedioate |
| SMILES | C=C(C)c1cc(C(CCCC)C(C(=O)OC2CC(C)(C)N(C)C(C)(C)C2)C(=O)OC2CC(C)(C)N(C)C(C)(C)C2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C41H68N2O5/c1-17-18-19-30(27-20-31(26(2)3)34(44)32(21-27)37(4,5)6)33(35(45)47-28-22-38(7,8)42(15)39(9,10)23-28)36(46)48-29-24-40(11,12)43(16)41(13,14)25-29/h20-21,28-30,33,44H,2,17-19,22-25H2,1,3-16H3 |
| InChIKey | BCVCKZANHZCSRM-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.00 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|