About (Z)-3,5-dimethyl-4-methylsulfanyloct-5-en-1-yne
(Z)-3,5-dimethyl-4-methylsulfanyloct-5-en-1-yne (PubChem CID 87160349) has the molecular formula C11H18S
and a molecular weight of 182.33 g/mol. Its IUPAC name is (Z)-3,5-dimethyl-4-methylsulfanyloct-5-en-1-yne.
Molecular Properties
| Compound Name | (Z)-3,5-dimethyl-4-methylsulfanyloct-5-en-1-yne |
| PubChem CID | 87160349 |
| Molecular Formula | C11H18S |
| Molecular Weight | 182.33 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (Z)-3,5-dimethyl-4-methylsulfanyloct-5-en-1-yne |
| SMILES | C#CC(C)C(SC)/C(C)=C\CC |
| InChI | InChI=1S/C11H18S/c1-6-8-10(4)11(12-5)9(3)7-2/h2,8-9,11H,6H2,1,3-5H3/b10-8- |
| InChIKey | UNOKGDCEHZEESL-NTMALXAHSA-N |
| XLogP | 3.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3,5-dimethyl-4-methylsulfanyloct-5-en-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3,5-dimethyl-4-methylsulfanyloct-5-en-1-yne?
The IUPAC name of (Z)-3,5-dimethyl-4-methylsulfanyloct-5-en-1-yne (CID 87160349) is (Z)-3,5-dimethyl-4-methylsulfanyloct-5-en-1-yne.
What is the SMILES notation for (Z)-3,5-dimethyl-4-methylsulfanyloct-5-en-1-yne?
The canonical SMILES for (Z)-3,5-dimethyl-4-methylsulfanyloct-5-en-1-yne is C#CC(C)C(SC)/C(C)=C\CC.
What is the InChIKey of (Z)-3,5-dimethyl-4-methylsulfanyloct-5-en-1-yne?
The InChIKey is UNOKGDCEHZEESL-NTMALXAHSA-N. The full InChI is InChI=1S/C11H18S/c1-6-8-10(4)11(12-5)9(3)7-2/h2,8-9,11H,6H2,1,3-5H3/b10-8-.
What are the key properties of (Z)-3,5-dimethyl-4-methylsulfanyloct-5-en-1-yne?
(Z)-3,5-dimethyl-4-methylsulfanyloct-5-en-1-yne has a molecular weight of 182.33 g/mol, XLogP of 3.34, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3,5-dimethyl-4-methylsulfanyloct-5-en-1-yne is sourced from PubChem (CID 87160349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).