About CID 87160619
CID 87160619 (PubChem CID 87160619) has the molecular formula C19H12BF9N2O
and a molecular weight of 466.11 g/mol.
Molecular Properties
| Compound Name | CID 87160619 |
| PubChem CID | 87160619 |
| Molecular Formula | C19H12BF9N2O |
| Molecular Weight | 466.11 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | — |
| SMILES | [B]c1nc(N2CCC(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)(C(F)(F)F)C2)ccc1C=O |
| InChI | InChI=1S/C19H12BF9N2O/c20-15-10(8-32)1-2-14(30-15)31-4-3-16(9-31,19(27,28)29)11-5-12(17(21,22)23)7-13(6-11)18(24,25)26/h1-2,5-8H,3-4,9H2 |
| InChIKey | ZEMOBTFHMNBGHL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.11 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87160619 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87160619?
The IUPAC name of CID 87160619 (CID 87160619) is not available.
What is the SMILES notation for CID 87160619?
The canonical SMILES for CID 87160619 is [B]c1nc(N2CCC(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)(C(F)(F)F)C2)ccc1C=O.
What is the InChIKey of CID 87160619?
The InChIKey is ZEMOBTFHMNBGHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12BF9N2O/c20-15-10(8-32)1-2-14(30-15)31-4-3-16(9-31,19(27,28)29)11-5-12(17(21,22)23)7-13(6-11)18(24,25)26/h1-2,5-8H,3-4,9H2.
What are the key properties of CID 87160619?
CID 87160619 has a molecular weight of 466.11 g/mol, XLogP of 4.44, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87160619 is sourced from PubChem (CID 87160619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).