About (1E)-N-ethyl-2,6-dimethylhepta-1,5-diene-1-sulfonamide
(1E)-N-ethyl-2,6-dimethylhepta-1,5-diene-1-sulfonamide (PubChem CID 87160698) has the molecular formula C11H21NO2S
and a molecular weight of 231.36 g/mol. Its IUPAC name is (1E)-N-ethyl-2,6-dimethylhepta-1,5-diene-1-sulfonamide.
Molecular Properties
| Compound Name | (1E)-N-ethyl-2,6-dimethylhepta-1,5-diene-1-sulfonamide |
| PubChem CID | 87160698 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | (1E)-N-ethyl-2,6-dimethylhepta-1,5-diene-1-sulfonamide |
| SMILES | CCNS(=O)(=O)/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C11H21NO2S/c1-5-12-15(13,14)9-11(4)8-6-7-10(2)3/h7,9,12H,5-6,8H2,1-4H3/b11-9+ |
| InChIKey | RFLTWHVPWWBEII-PKNBQFBNSA-N |
| XLogP | 2.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1E)-N-ethyl-2,6-dimethylhepta-1,5-diene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-N-ethyl-2,6-dimethylhepta-1,5-diene-1-sulfonamide?
The IUPAC name of (1E)-N-ethyl-2,6-dimethylhepta-1,5-diene-1-sulfonamide (CID 87160698) is (1E)-N-ethyl-2,6-dimethylhepta-1,5-diene-1-sulfonamide.
What is the SMILES notation for (1E)-N-ethyl-2,6-dimethylhepta-1,5-diene-1-sulfonamide?
The canonical SMILES for (1E)-N-ethyl-2,6-dimethylhepta-1,5-diene-1-sulfonamide is CCNS(=O)(=O)/C=C(\C)CCC=C(C)C.
What is the InChIKey of (1E)-N-ethyl-2,6-dimethylhepta-1,5-diene-1-sulfonamide?
The InChIKey is RFLTWHVPWWBEII-PKNBQFBNSA-N. The full InChI is InChI=1S/C11H21NO2S/c1-5-12-15(13,14)9-11(4)8-6-7-10(2)3/h7,9,12H,5-6,8H2,1-4H3/b11-9+.
What are the key properties of (1E)-N-ethyl-2,6-dimethylhepta-1,5-diene-1-sulfonamide?
(1E)-N-ethyl-2,6-dimethylhepta-1,5-diene-1-sulfonamide has a molecular weight of 231.36 g/mol, XLogP of 2.58, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-N-ethyl-2,6-dimethylhepta-1,5-diene-1-sulfonamide is sourced from PubChem (CID 87160698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).