About 6-chloro-3-nitroso-1H-1,5-naphthyridin-4-one
6-chloro-3-nitroso-1H-1,5-naphthyridin-4-one (PubChem CID 87160749) has the molecular formula C8H4ClN3O2
and a molecular weight of 209.59 g/mol. Its IUPAC name is 6-chloro-3-nitroso-1H-1,5-naphthyridin-4-one.
Molecular Properties
| Compound Name | 6-chloro-3-nitroso-1H-1,5-naphthyridin-4-one |
| PubChem CID | 87160749 |
| Molecular Formula | C8H4ClN3O2 |
| Molecular Weight | 209.59 g/mol |
| Exact Mass | 209.00 |
| IUPAC Name | 6-chloro-3-nitroso-1H-1,5-naphthyridin-4-one |
| SMILES | O=Nc1c[nH]c2ccc(Cl)nc2c1=O |
| InChI | InChI=1S/C8H4ClN3O2/c9-6-2-1-4-7(11-6)8(13)5(12-14)3-10-4/h1-3H,(H,10,13) |
| InChIKey | HVFIEXLXIBSMTR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 75.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.59 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-3-nitroso-1H-1,5-naphthyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-nitroso-1H-1,5-naphthyridin-4-one?
The IUPAC name of 6-chloro-3-nitroso-1H-1,5-naphthyridin-4-one (CID 87160749) is 6-chloro-3-nitroso-1H-1,5-naphthyridin-4-one.
What is the SMILES notation for 6-chloro-3-nitroso-1H-1,5-naphthyridin-4-one?
The canonical SMILES for 6-chloro-3-nitroso-1H-1,5-naphthyridin-4-one is O=Nc1c[nH]c2ccc(Cl)nc2c1=O.
What is the InChIKey of 6-chloro-3-nitroso-1H-1,5-naphthyridin-4-one?
The InChIKey is HVFIEXLXIBSMTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4ClN3O2/c9-6-2-1-4-7(11-6)8(13)5(12-14)3-10-4/h1-3H,(H,10,13).
What are the key properties of 6-chloro-3-nitroso-1H-1,5-naphthyridin-4-one?
6-chloro-3-nitroso-1H-1,5-naphthyridin-4-one has a molecular weight of 209.59 g/mol, XLogP of 1.97, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-nitroso-1H-1,5-naphthyridin-4-one is sourced from PubChem (CID 87160749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).