C74H62N2O4 — CID 87160894
1-N,1-N'-bis[(1S)-2-hydroxy-1-naphthalen-1-yl-3-naphthalen-2-yl-2-(naphthalen-2-ylmethyl)propyl]cyclobutane-1,1-dicarboxamide (PubChem CID 87160894) has the molecular formula C74H62N2O4 and a molecular weight of 1043.32 g/mol. Its IUPAC name is 1-N,1-N'-bis[(1S)-2-hydroxy-1-naphthalen-1-yl-3-naphthalen-2-yl-2-(naphthalen-2-ylmethyl)propyl]cyclobutane-1,1-dicarboxamide.
| Compound Name | 1-N,1-N'-bis[(1S)-2-hydroxy-1-naphthalen-1-yl-3-naphthalen-2-yl-2-(naphthalen-2-ylmethyl)propyl]cyclobutane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 87160894 |
| Molecular Formula | C74H62N2O4 |
| Molecular Weight | 1043.32 g/mol |
| Exact Mass | 1042.47 |
| IUPAC Name | 1-N,1-N'-bis[(1S)-2-hydroxy-1-naphthalen-1-yl-3-naphthalen-2-yl-2-(naphthalen-2-ylmethyl)propyl]cyclobutane-1,1-dicarboxamide |
| SMILES | O=C(N[C@@H](c1cccc2ccccc12)C(O)(Cc1ccc2ccccc2c1)Cc1ccc2ccccc2c1)C1(C(=O)N[C@@H](c2cccc3ccccc23)C(O)(Cc2ccc3ccccc3c2)Cc2ccc3ccccc3c2)CCC1 |
| InChI | InChI=1S/C74H62N2O4/c77-70(75-68(66-30-13-26-58-20-9-11-28-64(58)66)73(79,46-50-32-36-54-16-1-5-22-60(54)42-50)47-51-33-37-55-17-2-6-23-61(55)43-51)72(40-15-41-72)71(78)76-69(67-31-14-27-59-21-10-12-29-65(59)67)74(80,48-52-34-38-56-18-3-7-24-62(56)44-52)49-53-35-39-57-19-4-8-25-63(57)45-53/h1-14,16-39,42-45,68-69,79-80H,15,40-41,46-49H2,(H,75,77)(H,76,78)/t68-,69-/m0/s1 |
| InChIKey | QAXGKTIIGGUELX-NNAPYRDBSA-N |
| XLogP | 15.22 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1043.32 |
| LogP ≤ 5 | 15.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|