About 3,4-diamino-2-sulfobenzoic acid
3,4-diamino-2-sulfobenzoic acid (PubChem CID 87161662) has the molecular formula C7H8N2O5S
and a molecular weight of 232.22 g/mol. Its IUPAC name is 3,4-diamino-2-sulfobenzoic acid.
Molecular Properties
| Compound Name | 3,4-diamino-2-sulfobenzoic acid |
| PubChem CID | 87161662 |
| Molecular Formula | C7H8N2O5S |
| Molecular Weight | 232.22 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | 3,4-diamino-2-sulfobenzoic acid |
| SMILES | Nc1ccc(C(=O)O)c(S(=O)(=O)O)c1N |
| InChI | InChI=1S/C7H8N2O5S/c8-4-2-1-3(7(10)11)6(5(4)9)15(12,13)14/h1-2H,8-9H2,(H,10,11)(H,12,13,14) |
| InChIKey | UNOFDBUAOKLVQK-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.22 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diamino-2-sulfobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diamino-2-sulfobenzoic acid?
The IUPAC name of 3,4-diamino-2-sulfobenzoic acid (CID 87161662) is 3,4-diamino-2-sulfobenzoic acid.
What is the SMILES notation for 3,4-diamino-2-sulfobenzoic acid?
The canonical SMILES for 3,4-diamino-2-sulfobenzoic acid is Nc1ccc(C(=O)O)c(S(=O)(=O)O)c1N.
What is the InChIKey of 3,4-diamino-2-sulfobenzoic acid?
The InChIKey is UNOFDBUAOKLVQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O5S/c8-4-2-1-3(7(10)11)6(5(4)9)15(12,13)14/h1-2H,8-9H2,(H,10,11)(H,12,13,14).
What are the key properties of 3,4-diamino-2-sulfobenzoic acid?
3,4-diamino-2-sulfobenzoic acid has a molecular weight of 232.22 g/mol, XLogP of -0.20, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diamino-2-sulfobenzoic acid is sourced from PubChem (CID 87161662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).