C15H28O — CID 87161693
(8E,10E)-3,7,9-trimethyldodeca-8,10-dien-6-ol (PubChem CID 87161693) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is (8E,10E)-3,7,9-trimethyldodeca-8,10-dien-6-ol.
| Compound Name | (8E,10E)-3,7,9-trimethyldodeca-8,10-dien-6-ol |
|---|---|
| PubChem CID | 87161693 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | (8E,10E)-3,7,9-trimethyldodeca-8,10-dien-6-ol |
| SMILES | C/C=C/C(C)=C/C(C)C(O)CCC(C)CC |
| InChI | InChI=1S/C15H28O/c1-6-8-13(4)11-14(5)15(16)10-9-12(3)7-2/h6,8,11-12,14-16H,7,9-10H2,1-5H3/b8-6+,13-11+ |
| InChIKey | XQCDQMOVHDXOJP-VAFZVJGJSA-N |
| XLogP | 4.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|