About bis[2-amino-2-(2,6-dimethylphenyl)ethyl]azanide;dichlororuthenium
bis[2-amino-2-(2,6-dimethylphenyl)ethyl]azanide;dichlororuthenium (PubChem CID 87161798) has the molecular formula C20H28Cl2N3Ru-
and a molecular weight of 482.44 g/mol. Its IUPAC name is bis[2-amino-2-(2,6-dimethylphenyl)ethyl]azanide;dichlororuthenium.
Molecular Properties
| Compound Name | bis[2-amino-2-(2,6-dimethylphenyl)ethyl]azanide;dichlororuthenium |
| PubChem CID | 87161798 |
| Molecular Formula | C20H28Cl2N3Ru- |
| Molecular Weight | 482.44 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | bis[2-amino-2-(2,6-dimethylphenyl)ethyl]azanide;dichlororuthenium |
| SMILES | Cc1cccc(C)c1C(N)C[N-]CC(N)c1c(C)cccc1C.Cl[Ru]Cl |
| InChI | InChI=1S/C20H28N3.2ClH.Ru/c1-13-7-5-8-14(2)19(13)17(21)11-23-12-18(22)20-15(3)9-6-10-16(20)4;;;/h5-10,17-18H,11-12,21-22H2,1-4H3;2*1H;/q-1;;;+2/p-2 |
| InChIKey | CVDUHNMPLHJTEA-UHFFFAOYSA-L |
| XLogP | 5.37 |
| TPSA | 66.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.44 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis[2-amino-2-(2,6-dimethylphenyl)ethyl]azanide;dichlororuthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-amino-2-(2,6-dimethylphenyl)ethyl]azanide;dichlororuthenium?
The IUPAC name of bis[2-amino-2-(2,6-dimethylphenyl)ethyl]azanide;dichlororuthenium (CID 87161798) is bis[2-amino-2-(2,6-dimethylphenyl)ethyl]azanide;dichlororuthenium.
What is the SMILES notation for bis[2-amino-2-(2,6-dimethylphenyl)ethyl]azanide;dichlororuthenium?
The canonical SMILES for bis[2-amino-2-(2,6-dimethylphenyl)ethyl]azanide;dichlororuthenium is Cc1cccc(C)c1C(N)C[N-]CC(N)c1c(C)cccc1C.Cl[Ru]Cl.
What is the InChIKey of bis[2-amino-2-(2,6-dimethylphenyl)ethyl]azanide;dichlororuthenium?
The InChIKey is CVDUHNMPLHJTEA-UHFFFAOYSA-L. The full InChI is InChI=1S/C20H28N3.2ClH.Ru/c1-13-7-5-8-14(2)19(13)17(21)11-23-12-18(22)20-15(3)9-6-10-16(20)4;;;/h5-10,17-18H,11-12,21-22H2,1-4H3;2*1H;/q-1;;;+2/p-2.
What are the key properties of bis[2-amino-2-(2,6-dimethylphenyl)ethyl]azanide;dichlororuthenium?
bis[2-amino-2-(2,6-dimethylphenyl)ethyl]azanide;dichlororuthenium has a molecular weight of 482.44 g/mol, XLogP of 5.37, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-amino-2-(2,6-dimethylphenyl)ethyl]azanide;dichlororuthenium is sourced from PubChem (CID 87161798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).