C16H12BrN — CID 87162109
8-bromo-5-methyl-4bH-indeno[1,2-b]indole (PubChem CID 87162109) has the molecular formula C16H12BrN and a molecular weight of 298.18 g/mol. Its IUPAC name is 8-bromo-5-methyl-4bH-indeno[1,2-b]indole.
| Compound Name | 8-bromo-5-methyl-4bH-indeno[1,2-b]indole |
|---|---|
| PubChem CID | 87162109 |
| Molecular Formula | C16H12BrN |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | 8-bromo-5-methyl-4bH-indeno[1,2-b]indole |
| SMILES | CN1c2ccc(Br)cc2C2=Cc3ccccc3C21 |
| InChI | InChI=1S/C16H12BrN/c1-18-15-7-6-11(17)9-13(15)14-8-10-4-2-3-5-12(10)16(14)18/h2-9,16H,1H3 |
| InChIKey | GXGNRSRENCBAHF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|