C32H26AlBF15OSi2- — CID 87162707
[4-dimethylalumanyloxy-3,5-bis(trimethylsilyl)phenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 87162707) has the molecular formula C32H26AlBF15OSi2- and a molecular weight of 805.49 g/mol. Its IUPAC name is [4-dimethylalumanyloxy-3,5-bis(trimethylsilyl)phenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | [4-dimethylalumanyloxy-3,5-bis(trimethylsilyl)phenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 87162707 |
| Molecular Formula | C32H26AlBF15OSi2- |
| Molecular Weight | 805.49 g/mol |
| Exact Mass | 805.12 |
| IUPAC Name | [4-dimethylalumanyloxy-3,5-bis(trimethylsilyl)phenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | C[Al](C)Oc1c([Si](C)(C)C)cc([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)cc1[Si](C)(C)C |
| InChI | InChI=1S/C30H21BF15OSi2.2CH3.Al/c1-48(2,3)10-7-9(8-11(30(10)47)49(4,5)6)31(12-15(32)21(38)27(44)22(39)16(12)33,13-17(34)23(40)28(45)24(41)18(13)35)14-19(36)25(42)29(46)26(43)20(14)37;;;/h7-8,47H,1-6H3;2*1H3;/q-1;;;+1/p-1 |
| InChIKey | HSWCBSBLGIKUOL-UHFFFAOYSA-M |
| XLogP | 6.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.49 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|