C18H17ClN2 — CID 871628
7-chloro-4-methyl-N-(2-phenylethyl)quinolin-2-amine (PubChem CID 871628) has the molecular formula C18H17ClN2 and a molecular weight of 296.80 g/mol. Its IUPAC name is 7-chloro-4-methyl-N-(2-phenylethyl)quinolin-2-amine.
| Compound Name | 7-chloro-4-methyl-N-(2-phenylethyl)quinolin-2-amine |
|---|---|
| PubChem CID | 871628 |
| Molecular Formula | C18H17ClN2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 7-chloro-4-methyl-N-(2-phenylethyl)quinolin-2-amine |
| SMILES | Cc1cc(NCCc2ccccc2)nc2cc(Cl)ccc12 |
| InChI | InChI=1S/C18H17ClN2/c1-13-11-18(20-10-9-14-5-3-2-4-6-14)21-17-12-15(19)7-8-16(13)17/h2-8,11-12H,9-10H2,1H3,(H,20,21) |
| InChIKey | ILNSUNPYTLGEMW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |