About 1-hydroxyethyl 2-methylideneoctanoate
1-hydroxyethyl 2-methylideneoctanoate (PubChem CID 87163204) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is 1-hydroxyethyl 2-methylideneoctanoate.
Molecular Properties
| Compound Name | 1-hydroxyethyl 2-methylideneoctanoate |
| PubChem CID | 87163204 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 1-hydroxyethyl 2-methylideneoctanoate |
| SMILES | C=C(CCCCCC)C(=O)OC(C)O |
| InChI | InChI=1S/C11H20O3/c1-4-5-6-7-8-9(2)11(13)14-10(3)12/h10,12H,2,4-8H2,1,3H3 |
| InChIKey | ZXCPDIUNZMLDIF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxyethyl 2-methylideneoctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxyethyl 2-methylideneoctanoate?
The IUPAC name of 1-hydroxyethyl 2-methylideneoctanoate (CID 87163204) is 1-hydroxyethyl 2-methylideneoctanoate.
What is the SMILES notation for 1-hydroxyethyl 2-methylideneoctanoate?
The canonical SMILES for 1-hydroxyethyl 2-methylideneoctanoate is C=C(CCCCCC)C(=O)OC(C)O.
What is the InChIKey of 1-hydroxyethyl 2-methylideneoctanoate?
The InChIKey is ZXCPDIUNZMLDIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-4-5-6-7-8-9(2)11(13)14-10(3)12/h10,12H,2,4-8H2,1,3H3.
What are the key properties of 1-hydroxyethyl 2-methylideneoctanoate?
1-hydroxyethyl 2-methylideneoctanoate has a molecular weight of 200.28 g/mol, XLogP of 2.39, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxyethyl 2-methylideneoctanoate is sourced from PubChem (CID 87163204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).