About pent-4-yne-1,2,5-tricarbonitrile
pent-4-yne-1,2,5-tricarbonitrile (PubChem CID 87163272) has the molecular formula C8H5N3
and a molecular weight of 143.15 g/mol. Its IUPAC name is pent-4-yne-1,2,5-tricarbonitrile.
Molecular Properties
| Compound Name | pent-4-yne-1,2,5-tricarbonitrile |
| PubChem CID | 87163272 |
| Molecular Formula | C8H5N3 |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | pent-4-yne-1,2,5-tricarbonitrile |
| SMILES | N#CC#CCC(C#N)CC#N |
| InChI | InChI=1S/C8H5N3/c9-5-2-1-3-8(7-11)4-6-10/h8H,3-4H2 |
| InChIKey | SEPSJIGPSXDYBQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze pent-4-yne-1,2,5-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-4-yne-1,2,5-tricarbonitrile?
The IUPAC name of pent-4-yne-1,2,5-tricarbonitrile (CID 87163272) is pent-4-yne-1,2,5-tricarbonitrile.
What is the SMILES notation for pent-4-yne-1,2,5-tricarbonitrile?
The canonical SMILES for pent-4-yne-1,2,5-tricarbonitrile is N#CC#CCC(C#N)CC#N.
What is the InChIKey of pent-4-yne-1,2,5-tricarbonitrile?
The InChIKey is SEPSJIGPSXDYBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3/c9-5-2-1-3-8(7-11)4-6-10/h8H,3-4H2.
What are the key properties of pent-4-yne-1,2,5-tricarbonitrile?
pent-4-yne-1,2,5-tricarbonitrile has a molecular weight of 143.15 g/mol, XLogP of 0.96, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pent-4-yne-1,2,5-tricarbonitrile is sourced from PubChem (CID 87163272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).