About 6-methyl-1,4-dioxane-2,3,5-trione
6-methyl-1,4-dioxane-2,3,5-trione (PubChem CID 87163287) has the molecular formula C5H4O5
and a molecular weight of 144.08 g/mol. Its IUPAC name is 6-methyl-1,4-dioxane-2,3,5-trione.
Molecular Properties
| Compound Name | 6-methyl-1,4-dioxane-2,3,5-trione |
| PubChem CID | 87163287 |
| Molecular Formula | C5H4O5 |
| Molecular Weight | 144.08 g/mol |
| Exact Mass | 144.01 |
| IUPAC Name | 6-methyl-1,4-dioxane-2,3,5-trione |
| SMILES | CC1OC(=O)C(=O)OC1=O |
| InChI | InChI=1S/C5H4O5/c1-2-3(6)10-5(8)4(7)9-2/h2H,1H3 |
| InChIKey | NTTULJUSPMCGAG-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.08 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-1,4-dioxane-2,3,5-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1,4-dioxane-2,3,5-trione?
The IUPAC name of 6-methyl-1,4-dioxane-2,3,5-trione (CID 87163287) is 6-methyl-1,4-dioxane-2,3,5-trione.
What is the SMILES notation for 6-methyl-1,4-dioxane-2,3,5-trione?
The canonical SMILES for 6-methyl-1,4-dioxane-2,3,5-trione is CC1OC(=O)C(=O)OC1=O.
What is the InChIKey of 6-methyl-1,4-dioxane-2,3,5-trione?
The InChIKey is NTTULJUSPMCGAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4O5/c1-2-3(6)10-5(8)4(7)9-2/h2H,1H3.
What are the key properties of 6-methyl-1,4-dioxane-2,3,5-trione?
6-methyl-1,4-dioxane-2,3,5-trione has a molecular weight of 144.08 g/mol, XLogP of -1.00, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1,4-dioxane-2,3,5-trione is sourced from PubChem (CID 87163287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).