About N-iodo-3,5-bis(prop-2-enyl)adamantan-1-amine
N-iodo-3,5-bis(prop-2-enyl)adamantan-1-amine (PubChem CID 87163356) has the molecular formula C16H24IN
and a molecular weight of 357.28 g/mol. Its IUPAC name is N-iodo-3,5-bis(prop-2-enyl)adamantan-1-amine.
Molecular Properties
| Compound Name | N-iodo-3,5-bis(prop-2-enyl)adamantan-1-amine |
| PubChem CID | 87163356 |
| Molecular Formula | C16H24IN |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | N-iodo-3,5-bis(prop-2-enyl)adamantan-1-amine |
| SMILES | C=CCC12CC3CC(CC=C)(C1)CC(NI)(C3)C2 |
| InChI | InChI=1S/C16H24IN/c1-3-5-14-7-13-8-15(10-14,6-4-2)12-16(9-13,11-14)18-17/h3-4,13,18H,1-2,5-12H2 |
| InChIKey | TZLXYXUYFXRAEP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-iodo-3,5-bis(prop-2-enyl)adamantan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-iodo-3,5-bis(prop-2-enyl)adamantan-1-amine?
The IUPAC name of N-iodo-3,5-bis(prop-2-enyl)adamantan-1-amine (CID 87163356) is N-iodo-3,5-bis(prop-2-enyl)adamantan-1-amine.
What is the SMILES notation for N-iodo-3,5-bis(prop-2-enyl)adamantan-1-amine?
The canonical SMILES for N-iodo-3,5-bis(prop-2-enyl)adamantan-1-amine is C=CCC12CC3CC(CC=C)(C1)CC(NI)(C3)C2.
What is the InChIKey of N-iodo-3,5-bis(prop-2-enyl)adamantan-1-amine?
The InChIKey is TZLXYXUYFXRAEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24IN/c1-3-5-14-7-13-8-15(10-14,6-4-2)12-16(9-13,11-14)18-17/h3-4,13,18H,1-2,5-12H2.
What are the key properties of N-iodo-3,5-bis(prop-2-enyl)adamantan-1-amine?
N-iodo-3,5-bis(prop-2-enyl)adamantan-1-amine has a molecular weight of 357.28 g/mol, XLogP of 4.79, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-iodo-3,5-bis(prop-2-enyl)adamantan-1-amine is sourced from PubChem (CID 87163356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).