C10H14ClN5O2S — CID 87163994
6-chloro-3-(2-methylsulfonylethyl)-4H-pyrido[3,2-d]pyrimidine-2,4-diamine (PubChem CID 87163994) has the molecular formula C10H14ClN5O2S and a molecular weight of 303.78 g/mol. Its IUPAC name is 6-chloro-3-(2-methylsulfonylethyl)-4H-pyrido[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 6-chloro-3-(2-methylsulfonylethyl)-4H-pyrido[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 87163994 |
| Molecular Formula | C10H14ClN5O2S |
| Molecular Weight | 303.78 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 6-chloro-3-(2-methylsulfonylethyl)-4H-pyrido[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CS(=O)(=O)CCN1C(N)=Nc2ccc(Cl)nc2C1N |
| InChI | InChI=1S/C10H14ClN5O2S/c1-19(17,18)5-4-16-9(12)8-6(14-10(16)13)2-3-7(11)15-8/h2-3,9H,4-5,12H2,1H3,(H2,13,14) |
| InChIKey | ICAPDIRFBWCSHC-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.78 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|