About N-[(1Z)-3-methylidenepenta-1,4-dienyl]methanimine
N-[(1Z)-3-methylidenepenta-1,4-dienyl]methanimine (PubChem CID 87164006) has the molecular formula C7H9N
and a molecular weight of 107.16 g/mol. Its IUPAC name is N-[(1Z)-3-methylidenepenta-1,4-dienyl]methanimine.
Molecular Properties
| Compound Name | N-[(1Z)-3-methylidenepenta-1,4-dienyl]methanimine |
| PubChem CID | 87164006 |
| Molecular Formula | C7H9N |
| Molecular Weight | 107.16 g/mol |
| Exact Mass | 107.07 |
| IUPAC Name | N-[(1Z)-3-methylidenepenta-1,4-dienyl]methanimine |
| SMILES | C=CC(=C)/C=C\N=C |
| InChI | InChI=1S/C7H9N/c1-4-7(2)5-6-8-3/h4-6H,1-3H2/b6-5- |
| InChIKey | NSVHYMWKRUYVPQ-WAYWQWQTSA-N |
| XLogP | 1.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.16 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1Z)-3-methylidenepenta-1,4-dienyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1Z)-3-methylidenepenta-1,4-dienyl]methanimine?
The IUPAC name of N-[(1Z)-3-methylidenepenta-1,4-dienyl]methanimine (CID 87164006) is N-[(1Z)-3-methylidenepenta-1,4-dienyl]methanimine.
What is the SMILES notation for N-[(1Z)-3-methylidenepenta-1,4-dienyl]methanimine?
The canonical SMILES for N-[(1Z)-3-methylidenepenta-1,4-dienyl]methanimine is C=CC(=C)/C=C\N=C.
What is the InChIKey of N-[(1Z)-3-methylidenepenta-1,4-dienyl]methanimine?
The InChIKey is NSVHYMWKRUYVPQ-WAYWQWQTSA-N. The full InChI is InChI=1S/C7H9N/c1-4-7(2)5-6-8-3/h4-6H,1-3H2/b6-5-.
What are the key properties of N-[(1Z)-3-methylidenepenta-1,4-dienyl]methanimine?
N-[(1Z)-3-methylidenepenta-1,4-dienyl]methanimine has a molecular weight of 107.16 g/mol, XLogP of 1.94, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1Z)-3-methylidenepenta-1,4-dienyl]methanimine is sourced from PubChem (CID 87164006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).