C17H10ClF3N2O2 — CID 8716409
2-(5-chloroquinolin-8-yl)oxy-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 8716409) has the molecular formula C17H10ClF3N2O2 and a molecular weight of 366.73 g/mol. Its IUPAC name is 2-(5-chloroquinolin-8-yl)oxy-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(5-chloroquinolin-8-yl)oxy-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 8716409 |
| Molecular Formula | C17H10ClF3N2O2 |
| Molecular Weight | 366.73 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 2-(5-chloroquinolin-8-yl)oxy-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(COc1ccc(Cl)c2cccnc12)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H10ClF3N2O2/c18-10-3-6-13(17-9(10)2-1-7-22-17)25-8-14(24)23-12-5-4-11(19)15(20)16(12)21/h1-7H,8H2,(H,23,24) |
| InChIKey | QOHXSVPHAVMDTC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.73 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|