C16H21F5O4 — CID 87164217
[3-oxo-3-(2,2,3,3,3-pentafluoropropoxy)propyl] 2-(cyclohexylmethyl)prop-2-enoate (PubChem CID 87164217) has the molecular formula C16H21F5O4 and a molecular weight of 372.33 g/mol. Its IUPAC name is [3-oxo-3-(2,2,3,3,3-pentafluoropropoxy)propyl] 2-(cyclohexylmethyl)prop-2-enoate.
| Compound Name | [3-oxo-3-(2,2,3,3,3-pentafluoropropoxy)propyl] 2-(cyclohexylmethyl)prop-2-enoate |
|---|---|
| PubChem CID | 87164217 |
| Molecular Formula | C16H21F5O4 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | [3-oxo-3-(2,2,3,3,3-pentafluoropropoxy)propyl] 2-(cyclohexylmethyl)prop-2-enoate |
| SMILES | C=C(CC1CCCCC1)C(=O)OCCC(=O)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H21F5O4/c1-11(9-12-5-3-2-4-6-12)14(23)24-8-7-13(22)25-10-15(17,18)16(19,20)21/h12H,1-10H2 |
| InChIKey | HPYZNWWDQOABNX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|