About ethyl(methyl)azanium;sulfate
ethyl(methyl)azanium;sulfate (PubChem CID 87164883) has the molecular formula C6H20N2O4S
and a molecular weight of 216.30 g/mol. Its IUPAC name is ethyl(methyl)azanium;sulfate.
Molecular Properties
| Compound Name | ethyl(methyl)azanium;sulfate |
| PubChem CID | 87164883 |
| Molecular Formula | C6H20N2O4S |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | ethyl(methyl)azanium;sulfate |
| SMILES | CC[NH2+]C.CC[NH2+]C.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C3H9N.H2O4S/c2*1-3-4-2;1-5(2,3)4/h2*4H,3H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | ALXUNHSWRWIJKZ-UHFFFAOYSA-N |
| XLogP | -2.94 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze ethyl(methyl)azanium;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl(methyl)azanium;sulfate?
The IUPAC name of ethyl(methyl)azanium;sulfate (CID 87164883) is ethyl(methyl)azanium;sulfate.
What is the SMILES notation for ethyl(methyl)azanium;sulfate?
The canonical SMILES for ethyl(methyl)azanium;sulfate is CC[NH2+]C.CC[NH2+]C.O=S(=O)([O-])[O-].
What is the InChIKey of ethyl(methyl)azanium;sulfate?
The InChIKey is ALXUNHSWRWIJKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H9N.H2O4S/c2*1-3-4-2;1-5(2,3)4/h2*4H,3H2,1-2H3;(H2,1,2,3,4).
What are the key properties of ethyl(methyl)azanium;sulfate?
ethyl(methyl)azanium;sulfate has a molecular weight of 216.30 g/mol, XLogP of -2.94, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl(methyl)azanium;sulfate is sourced from PubChem (CID 87164883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).