C21H14ClFN2O2S — CID 87164936
N-[(3-chlorophenyl)-methyl-oxo-λ6-sulfanylidene]-5-[2-(3-fluorophenyl)ethynyl]pyridine-3-carboxamide (PubChem CID 87164936) has the molecular formula C21H14ClFN2O2S and a molecular weight of 412.87 g/mol. Its IUPAC name is N-[(3-chlorophenyl)-methyl-oxo-λ6-sulfanylidene]-5-[2-(3-fluorophenyl)ethynyl]pyridine-3-carboxamide.
| Compound Name | N-[(3-chlorophenyl)-methyl-oxo-λ6-sulfanylidene]-5-[2-(3-fluorophenyl)ethynyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87164936 |
| Molecular Formula | C21H14ClFN2O2S |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | N-[(3-chlorophenyl)-methyl-oxo-λ6-sulfanylidene]-5-[2-(3-fluorophenyl)ethynyl]pyridine-3-carboxamide |
| SMILES | CS(=O)(=NC(=O)c1cncc(C#Cc2cccc(F)c2)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H14ClFN2O2S/c1-28(27,20-7-3-5-18(22)12-20)25-21(26)17-10-16(13-24-14-17)9-8-15-4-2-6-19(23)11-15/h2-7,10-14H,1H3 |
| InChIKey | KWCAINZPZMPZQV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 59.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|