C18H40N2 — CID 87165727
N,N'-bis(3,3-dimethylbutan-2-yl)hexane-1,6-diamine (PubChem CID 87165727) has the molecular formula C18H40N2 and a molecular weight of 284.53 g/mol. Its IUPAC name is N,N'-bis(3,3-dimethylbutan-2-yl)hexane-1,6-diamine.
| Compound Name | N,N'-bis(3,3-dimethylbutan-2-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 87165727 |
| Molecular Formula | C18H40N2 |
| Molecular Weight | 284.53 g/mol |
| Exact Mass | 284.32 |
| IUPAC Name | N,N'-bis(3,3-dimethylbutan-2-yl)hexane-1,6-diamine |
| SMILES | CC(NCCCCCCNC(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H40N2/c1-15(17(3,4)5)19-13-11-9-10-12-14-20-16(2)18(6,7)8/h15-16,19-20H,9-14H2,1-8H3 |
| InChIKey | MORNPDNVUROSRS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|