About 5-butan-2-yl-2,3-diethylbenzene-1,4-diamine
5-butan-2-yl-2,3-diethylbenzene-1,4-diamine (PubChem CID 87165746) has the molecular formula C14H24N2
and a molecular weight of 220.36 g/mol. Its IUPAC name is 5-butan-2-yl-2,3-diethylbenzene-1,4-diamine.
Molecular Properties
| Compound Name | 5-butan-2-yl-2,3-diethylbenzene-1,4-diamine |
| PubChem CID | 87165746 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 5-butan-2-yl-2,3-diethylbenzene-1,4-diamine |
| SMILES | CCc1c(N)cc(C(C)CC)c(N)c1CC |
| InChI | InChI=1S/C14H24N2/c1-5-9(4)12-8-13(15)10(6-2)11(7-3)14(12)16/h8-9H,5-7,15-16H2,1-4H3 |
| InChIKey | ZQNCDDVHPDSDKC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-butan-2-yl-2,3-diethylbenzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butan-2-yl-2,3-diethylbenzene-1,4-diamine?
The IUPAC name of 5-butan-2-yl-2,3-diethylbenzene-1,4-diamine (CID 87165746) is 5-butan-2-yl-2,3-diethylbenzene-1,4-diamine.
What is the SMILES notation for 5-butan-2-yl-2,3-diethylbenzene-1,4-diamine?
The canonical SMILES for 5-butan-2-yl-2,3-diethylbenzene-1,4-diamine is CCc1c(N)cc(C(C)CC)c(N)c1CC.
What is the InChIKey of 5-butan-2-yl-2,3-diethylbenzene-1,4-diamine?
The InChIKey is ZQNCDDVHPDSDKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2/c1-5-9(4)12-8-13(15)10(6-2)11(7-3)14(12)16/h8-9H,5-7,15-16H2,1-4H3.
What are the key properties of 5-butan-2-yl-2,3-diethylbenzene-1,4-diamine?
5-butan-2-yl-2,3-diethylbenzene-1,4-diamine has a molecular weight of 220.36 g/mol, XLogP of 3.49, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butan-2-yl-2,3-diethylbenzene-1,4-diamine is sourced from PubChem (CID 87165746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).