C18H40N2 — CID 87166013
N,N'-bis(3,3-dimethylbutan-2-yl)-2-methylpentane-1,5-diamine (PubChem CID 87166013) has the molecular formula C18H40N2 and a molecular weight of 284.53 g/mol. Its IUPAC name is N,N'-bis(3,3-dimethylbutan-2-yl)-2-methylpentane-1,5-diamine.
| Compound Name | N,N'-bis(3,3-dimethylbutan-2-yl)-2-methylpentane-1,5-diamine |
|---|---|
| PubChem CID | 87166013 |
| Molecular Formula | C18H40N2 |
| Molecular Weight | 284.53 g/mol |
| Exact Mass | 284.32 |
| IUPAC Name | N,N'-bis(3,3-dimethylbutan-2-yl)-2-methylpentane-1,5-diamine |
| SMILES | CC(CCCNC(C)C(C)(C)C)CNC(C)C(C)(C)C |
| InChI | InChI=1S/C18H40N2/c1-14(13-20-16(3)18(7,8)9)11-10-12-19-15(2)17(4,5)6/h14-16,19-20H,10-13H2,1-9H3 |
| InChIKey | HGLSFWZWRNSPNZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|