C16H17N3O3 — CID 87166132
N-[(3R,5S)-1-azabicyclo[3.2.1]octan-3-yl]-3-formylfuro[2,3-c]pyridine-5-carboxamide (PubChem CID 87166132) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is N-[(3R,5S)-1-azabicyclo[3.2.1]octan-3-yl]-3-formylfuro[2,3-c]pyridine-5-carboxamide.
| Compound Name | N-[(3R,5S)-1-azabicyclo[3.2.1]octan-3-yl]-3-formylfuro[2,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 87166132 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-[(3R,5S)-1-azabicyclo[3.2.1]octan-3-yl]-3-formylfuro[2,3-c]pyridine-5-carboxamide |
| SMILES | O=Cc1coc2cnc(C(=O)N[C@@H]3C[C@@H]4CCN(C4)C3)cc12 |
| InChI | InChI=1S/C16H17N3O3/c20-8-11-9-22-15-5-17-14(4-13(11)15)16(21)18-12-3-10-1-2-19(6-10)7-12/h4-5,8-10,12H,1-3,6-7H2,(H,18,21)/t10-,12+/m0/s1 |
| InChIKey | JDHIIDVHVQIMNW-CMPLNLGQSA-N |
| XLogP | 1.46 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|