About (2R)-3-acetylsulfanyl-2-aminopropanoic acid;imidazolidine-2,4-dione
(2R)-3-acetylsulfanyl-2-aminopropanoic acid;imidazolidine-2,4-dione (PubChem CID 87167186) has the molecular formula C8H13N3O5S
and a molecular weight of 263.27 g/mol. Its IUPAC name is (2R)-3-acetylsulfanyl-2-aminopropanoic acid;imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | (2R)-3-acetylsulfanyl-2-aminopropanoic acid;imidazolidine-2,4-dione |
| PubChem CID | 87167186 |
| Molecular Formula | C8H13N3O5S |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | (2R)-3-acetylsulfanyl-2-aminopropanoic acid;imidazolidine-2,4-dione |
| SMILES | CC(=O)SC[C@H](N)C(=O)O.O=C1CNC(=O)N1 |
| InChI | InChI=1S/C5H9NO3S.C3H4N2O2/c1-3(7)10-2-4(6)5(8)9;6-2-1-4-3(7)5-2/h4H,2,6H2,1H3,(H,8,9);1H2,(H2,4,5,6,7)/t4-;/m0./s1 |
| InChIKey | DLZVBZGCPWUEMT-WCCKRBBISA-N |
| XLogP | -1.50 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze (2R)-3-acetylsulfanyl-2-aminopropanoic acid;imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-acetylsulfanyl-2-aminopropanoic acid;imidazolidine-2,4-dione?
The IUPAC name of (2R)-3-acetylsulfanyl-2-aminopropanoic acid;imidazolidine-2,4-dione (CID 87167186) is (2R)-3-acetylsulfanyl-2-aminopropanoic acid;imidazolidine-2,4-dione.
What is the SMILES notation for (2R)-3-acetylsulfanyl-2-aminopropanoic acid;imidazolidine-2,4-dione?
The canonical SMILES for (2R)-3-acetylsulfanyl-2-aminopropanoic acid;imidazolidine-2,4-dione is CC(=O)SC[C@H](N)C(=O)O.O=C1CNC(=O)N1.
What is the InChIKey of (2R)-3-acetylsulfanyl-2-aminopropanoic acid;imidazolidine-2,4-dione?
The InChIKey is DLZVBZGCPWUEMT-WCCKRBBISA-N. The full InChI is InChI=1S/C5H9NO3S.C3H4N2O2/c1-3(7)10-2-4(6)5(8)9;6-2-1-4-3(7)5-2/h4H,2,6H2,1H3,(H,8,9);1H2,(H2,4,5,6,7)/t4-;/m0./s1.
What are the key properties of (2R)-3-acetylsulfanyl-2-aminopropanoic acid;imidazolidine-2,4-dione?
(2R)-3-acetylsulfanyl-2-aminopropanoic acid;imidazolidine-2,4-dione has a molecular weight of 263.27 g/mol, XLogP of -1.50, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-acetylsulfanyl-2-aminopropanoic acid;imidazolidine-2,4-dione is sourced from PubChem (CID 87167186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).