C16H24O3 — CID 87167325
4,4-dimethyl-2-(2-phenylpropan-2-yl)pentaneperoxoic acid (PubChem CID 87167325) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is 4,4-dimethyl-2-(2-phenylpropan-2-yl)pentaneperoxoic acid.
| Compound Name | 4,4-dimethyl-2-(2-phenylpropan-2-yl)pentaneperoxoic acid |
|---|---|
| PubChem CID | 87167325 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 4,4-dimethyl-2-(2-phenylpropan-2-yl)pentaneperoxoic acid |
| SMILES | CC(C)(C)CC(C(=O)OO)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C16H24O3/c1-15(2,3)11-13(14(17)19-18)16(4,5)12-9-7-6-8-10-12/h6-10,13,18H,11H2,1-5H3 |
| InChIKey | BKSASJLKCAAPOD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|