About 4-chloro-5-[(3,4-difluorophenyl)methyl]-6-methylpyrimidine
4-chloro-5-[(3,4-difluorophenyl)methyl]-6-methylpyrimidine (PubChem CID 87167392) has the molecular formula C12H9ClF2N2
and a molecular weight of 254.67 g/mol. Its IUPAC name is 4-chloro-5-[(3,4-difluorophenyl)methyl]-6-methylpyrimidine.
Molecular Properties
| Compound Name | 4-chloro-5-[(3,4-difluorophenyl)methyl]-6-methylpyrimidine |
| PubChem CID | 87167392 |
| Molecular Formula | C12H9ClF2N2 |
| Molecular Weight | 254.67 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 4-chloro-5-[(3,4-difluorophenyl)methyl]-6-methylpyrimidine |
| SMILES | Cc1ncnc(Cl)c1Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H9ClF2N2/c1-7-9(12(13)17-6-16-7)4-8-2-3-10(14)11(15)5-8/h2-3,5-6H,4H2,1H3 |
| InChIKey | HXGOUZWQSLFKGT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.67 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-5-[(3,4-difluorophenyl)methyl]-6-methylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-[(3,4-difluorophenyl)methyl]-6-methylpyrimidine?
The IUPAC name of 4-chloro-5-[(3,4-difluorophenyl)methyl]-6-methylpyrimidine (CID 87167392) is 4-chloro-5-[(3,4-difluorophenyl)methyl]-6-methylpyrimidine.
What is the SMILES notation for 4-chloro-5-[(3,4-difluorophenyl)methyl]-6-methylpyrimidine?
The canonical SMILES for 4-chloro-5-[(3,4-difluorophenyl)methyl]-6-methylpyrimidine is Cc1ncnc(Cl)c1Cc1ccc(F)c(F)c1.
What is the InChIKey of 4-chloro-5-[(3,4-difluorophenyl)methyl]-6-methylpyrimidine?
The InChIKey is HXGOUZWQSLFKGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClF2N2/c1-7-9(12(13)17-6-16-7)4-8-2-3-10(14)11(15)5-8/h2-3,5-6H,4H2,1H3.
What are the key properties of 4-chloro-5-[(3,4-difluorophenyl)methyl]-6-methylpyrimidine?
4-chloro-5-[(3,4-difluorophenyl)methyl]-6-methylpyrimidine has a molecular weight of 254.67 g/mol, XLogP of 3.31, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-[(3,4-difluorophenyl)methyl]-6-methylpyrimidine is sourced from PubChem (CID 87167392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).