C12H28N2O — CID 87167758
(2R)-2-[[[(3R,4R)-4-amino-3-methylpentyl]amino]methyl]-2-methylbutan-1-ol (PubChem CID 87167758) has the molecular formula C12H28N2O and a molecular weight of 216.37 g/mol. Its IUPAC name is (2R)-2-[[[(3R,4R)-4-amino-3-methylpentyl]amino]methyl]-2-methylbutan-1-ol.
| Compound Name | (2R)-2-[[[(3R,4R)-4-amino-3-methylpentyl]amino]methyl]-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 87167758 |
| Molecular Formula | C12H28N2O |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.22 |
| IUPAC Name | (2R)-2-[[[(3R,4R)-4-amino-3-methylpentyl]amino]methyl]-2-methylbutan-1-ol |
| SMILES | CC[C@@](C)(CO)CNCC[C@@H](C)[C@@H](C)N |
| InChI | InChI=1S/C12H28N2O/c1-5-12(4,9-15)8-14-7-6-10(2)11(3)13/h10-11,14-15H,5-9,13H2,1-4H3/t10-,11-,12-/m1/s1 |
| InChIKey | QLMHFBWXOIPWHX-IJLUTSLNSA-N |
| XLogP | 1.36 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|