About CID 87167788
CID 87167788 (PubChem CID 87167788) has the molecular formula C12H20AsN4O
and a molecular weight of 311.24 g/mol.
Molecular Properties
| Compound Name | CID 87167788 |
| PubChem CID | 87167788 |
| Molecular Formula | C12H20AsN4O |
| Molecular Weight | 311.24 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | — |
| SMILES | CN[C@H]1CCN(c2ccnc([As]CCCO)n2)C1 |
| InChI | InChI=1S/C12H20AsN4O/c1-14-10-4-7-17(9-10)11-3-6-15-12(16-11)13-5-2-8-18/h3,6,10,14,18H,2,4-5,7-9H2,1H3/t10-/m0/s1 |
| InChIKey | BYSRAAFEMXFIFV-JTQLQIEISA-N |
| XLogP | -0.60 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.24 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87167788 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87167788?
The IUPAC name of CID 87167788 (CID 87167788) is not available.
What is the SMILES notation for CID 87167788?
The canonical SMILES for CID 87167788 is CN[C@H]1CCN(c2ccnc([As]CCCO)n2)C1.
What is the InChIKey of CID 87167788?
The InChIKey is BYSRAAFEMXFIFV-JTQLQIEISA-N. The full InChI is InChI=1S/C12H20AsN4O/c1-14-10-4-7-17(9-10)11-3-6-15-12(16-11)13-5-2-8-18/h3,6,10,14,18H,2,4-5,7-9H2,1H3/t10-/m0/s1.
What are the key properties of CID 87167788?
CID 87167788 has a molecular weight of 311.24 g/mol, XLogP of -0.60, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87167788 is sourced from PubChem (CID 87167788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).