C12H20AsN4O — CID 87167788
CID 87167788 (PubChem CID 87167788) has the molecular formula C12H20AsN4O and a molecular weight of 311.24 g/mol.
| Compound Name | CID 87167788 |
|---|---|
| PubChem CID | 87167788 |
| Molecular Formula | C12H20AsN4O |
| Molecular Weight | 311.24 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | — |
| SMILES | CN[C@H]1CCN(c2ccnc([As]CCCO)n2)C1 |
| InChI | InChI=1S/C12H20AsN4O/c1-14-10-4-7-17(9-10)11-3-6-15-12(16-11)13-5-2-8-18/h3,6,10,14,18H,2,4-5,7-9H2,1H3/t10-/m0/s1 |
| InChIKey | BYSRAAFEMXFIFV-JTQLQIEISA-N |
| XLogP | -0.60 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.24 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|