About 2-methylprop-1-ene;bis(propane-1,2-diol)
2-methylprop-1-ene;bis(propane-1,2-diol) (PubChem CID 87167791) has the molecular formula C10H24O4
and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-methylprop-1-ene;bis(propane-1,2-diol).
Molecular Properties
| Compound Name | 2-methylprop-1-ene;bis(propane-1,2-diol) |
| PubChem CID | 87167791 |
| Molecular Formula | C10H24O4 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 2-methylprop-1-ene;bis(propane-1,2-diol) |
| SMILES | C=C(C)C.CC(O)CO.CC(O)CO |
| InChI | InChI=1S/C4H8.2C3H8O2/c1-4(2)3;2*1-3(5)2-4/h1H2,2-3H3;2*3-5H,2H2,1H3 |
| InChIKey | MSXLUTQZKJGVFK-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-1-ene;bis(propane-1,2-diol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-1-ene;bis(propane-1,2-diol)?
The IUPAC name of 2-methylprop-1-ene;bis(propane-1,2-diol) (CID 87167791) is 2-methylprop-1-ene;bis(propane-1,2-diol).
What is the SMILES notation for 2-methylprop-1-ene;bis(propane-1,2-diol)?
The canonical SMILES for 2-methylprop-1-ene;bis(propane-1,2-diol) is C=C(C)C.CC(O)CO.CC(O)CO.
What is the InChIKey of 2-methylprop-1-ene;bis(propane-1,2-diol)?
The InChIKey is MSXLUTQZKJGVFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8.2C3H8O2/c1-4(2)3;2*1-3(5)2-4/h1H2,2-3H3;2*3-5H,2H2,1H3.
What are the key properties of 2-methylprop-1-ene;bis(propane-1,2-diol)?
2-methylprop-1-ene;bis(propane-1,2-diol) has a molecular weight of 208.30 g/mol, XLogP of 0.30, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-1-ene;bis(propane-1,2-diol) is sourced from PubChem (CID 87167791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).