C17H11BrCl3F3N2 — CID 87168052
2-bromo-4-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-5-yl]aniline (PubChem CID 87168052) has the molecular formula C17H11BrCl3F3N2 and a molecular weight of 486.55 g/mol. Its IUPAC name is 2-bromo-4-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-5-yl]aniline.
| Compound Name | 2-bromo-4-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-5-yl]aniline |
|---|---|
| PubChem CID | 87168052 |
| Molecular Formula | C17H11BrCl3F3N2 |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 483.91 |
| IUPAC Name | 2-bromo-4-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-5-yl]aniline |
| SMILES | Nc1ccc(C2=NCC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)cc1Br |
| InChI | InChI=1S/C17H11BrCl3F3N2/c18-10-3-8(1-2-13(10)25)14-6-16(7-26-14,17(22,23)24)9-4-11(19)15(21)12(20)5-9/h1-5H,6-7,25H2 |
| InChIKey | HHVCZVVHQSLWLC-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|