About 2-[ethyl(propyl)amino]acetic acid;prop-2-en-1-amine
2-[ethyl(propyl)amino]acetic acid;prop-2-en-1-amine (PubChem CID 87168079) has the molecular formula C10H22N2O2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-[ethyl(propyl)amino]acetic acid;prop-2-en-1-amine.
Molecular Properties
| Compound Name | 2-[ethyl(propyl)amino]acetic acid;prop-2-en-1-amine |
| PubChem CID | 87168079 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 2-[ethyl(propyl)amino]acetic acid;prop-2-en-1-amine |
| SMILES | C=CCN.CCCN(CC)CC(=O)O |
| InChI | InChI=1S/C7H15NO2.C3H7N/c1-3-5-8(4-2)6-7(9)10;1-2-3-4/h3-6H2,1-2H3,(H,9,10);2H,1,3-4H2 |
| InChIKey | BVCXBXKAATVHTQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[ethyl(propyl)amino]acetic acid;prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[ethyl(propyl)amino]acetic acid;prop-2-en-1-amine?
The IUPAC name of 2-[ethyl(propyl)amino]acetic acid;prop-2-en-1-amine (CID 87168079) is 2-[ethyl(propyl)amino]acetic acid;prop-2-en-1-amine.
What is the SMILES notation for 2-[ethyl(propyl)amino]acetic acid;prop-2-en-1-amine?
The canonical SMILES for 2-[ethyl(propyl)amino]acetic acid;prop-2-en-1-amine is C=CCN.CCCN(CC)CC(=O)O.
What is the InChIKey of 2-[ethyl(propyl)amino]acetic acid;prop-2-en-1-amine?
The InChIKey is BVCXBXKAATVHTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2.C3H7N/c1-3-5-8(4-2)6-7(9)10;1-2-3-4/h3-6H2,1-2H3,(H,9,10);2H,1,3-4H2.
What are the key properties of 2-[ethyl(propyl)amino]acetic acid;prop-2-en-1-amine?
2-[ethyl(propyl)amino]acetic acid;prop-2-en-1-amine has a molecular weight of 202.30 g/mol, XLogP of 0.93, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethyl(propyl)amino]acetic acid;prop-2-en-1-amine is sourced from PubChem (CID 87168079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).