C30H42N6O5 — CID 87168153
2-[4-[[3,5-bis[[4-(isocyanatomethyl)cyclohexyl]methyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]methyl]cyclohexyl]acetonitrile (PubChem CID 87168153) has the molecular formula C30H42N6O5 and a molecular weight of 566.70 g/mol. Its IUPAC name is 2-[4-[[3,5-bis[[4-(isocyanatomethyl)cyclohexyl]methyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]methyl]cyclohexyl]acetonitrile.
| Compound Name | 2-[4-[[3,5-bis[[4-(isocyanatomethyl)cyclohexyl]methyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]methyl]cyclohexyl]acetonitrile |
|---|---|
| PubChem CID | 87168153 |
| Molecular Formula | C30H42N6O5 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.32 |
| IUPAC Name | 2-[4-[[3,5-bis[[4-(isocyanatomethyl)cyclohexyl]methyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]methyl]cyclohexyl]acetonitrile |
| SMILES | N#CCC1CCC(Cn2c(=O)n(CC3CCC(CN=C=O)CC3)c(=O)n(CC3CCC(CN=C=O)CC3)c2=O)CC1 |
| InChI | InChI=1S/C30H42N6O5/c31-14-13-22-1-7-25(8-2-22)17-34-28(39)35(18-26-9-3-23(4-10-26)15-32-20-37)30(41)36(29(34)40)19-27-11-5-24(6-12-27)16-33-21-38/h22-27H,1-13,15-19H2 |
| InChIKey | NZVTYVKXTXAIDU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 148.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|