C20H10F14O2 — CID 87168407
4-(1,2,2,3,3,4,4,5,5,6,6,7,7,7-tetradecafluoro-1-phenylheptoxy)benzaldehyde (PubChem CID 87168407) has the molecular formula C20H10F14O2 and a molecular weight of 548.27 g/mol. Its IUPAC name is 4-(1,2,2,3,3,4,4,5,5,6,6,7,7,7-tetradecafluoro-1-phenylheptoxy)benzaldehyde.
| Compound Name | 4-(1,2,2,3,3,4,4,5,5,6,6,7,7,7-tetradecafluoro-1-phenylheptoxy)benzaldehyde |
|---|---|
| PubChem CID | 87168407 |
| Molecular Formula | C20H10F14O2 |
| Molecular Weight | 548.27 g/mol |
| Exact Mass | 548.05 |
| IUPAC Name | 4-(1,2,2,3,3,4,4,5,5,6,6,7,7,7-tetradecafluoro-1-phenylheptoxy)benzaldehyde |
| SMILES | O=Cc1ccc(OC(F)(c2ccccc2)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H10F14O2/c21-14(12-4-2-1-3-5-12,36-13-8-6-11(10-35)7-9-13)15(22,23)16(24,25)17(26,27)18(28,29)19(30,31)20(32,33)34/h1-10H |
| InChIKey | MLISCSUPCFYGMN-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.27 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|