C43H32F6N2O10 — CID 87168585
[4-(trifluoromethoxy)phenyl] 4-[(1E,8E)-5-(2,4-diaminophenyl)-6,6-dihydroxy-3,7-dioxo-9-[4-[4-(trifluoromethoxy)phenoxy]carbonylphenyl]nona-1,8-dienyl]benzoate (PubChem CID 87168585) has the molecular formula C43H32F6N2O10 and a molecular weight of 850.72 g/mol. Its IUPAC name is [4-(trifluoromethoxy)phenyl] 4-[(1E,8E)-5-(2,4-diaminophenyl)-6,6-dihydroxy-3,7-dioxo-9-[4-[4-(trifluoromethoxy)phenoxy]carbonylphenyl]nona-1,8-dienyl]benzoate.
| Compound Name | [4-(trifluoromethoxy)phenyl] 4-[(1E,8E)-5-(2,4-diaminophenyl)-6,6-dihydroxy-3,7-dioxo-9-[4-[4-(trifluoromethoxy)phenoxy]carbonylphenyl]nona-1,8-dienyl]benzoate |
|---|---|
| PubChem CID | 87168585 |
| Molecular Formula | C43H32F6N2O10 |
| Molecular Weight | 850.72 g/mol |
| Exact Mass | 850.20 |
| IUPAC Name | [4-(trifluoromethoxy)phenyl] 4-[(1E,8E)-5-(2,4-diaminophenyl)-6,6-dihydroxy-3,7-dioxo-9-[4-[4-(trifluoromethoxy)phenoxy]carbonylphenyl]nona-1,8-dienyl]benzoate |
| SMILES | Nc1ccc(C(CC(=O)/C=C/c2ccc(C(=O)Oc3ccc(OC(F)(F)F)cc3)cc2)C(O)(O)C(=O)/C=C/c2ccc(C(=O)Oc3ccc(OC(F)(F)F)cc3)cc2)c(N)c1 |
| InChI | InChI=1S/C43H32F6N2O10/c44-42(45,46)60-33-17-13-31(14-18-33)58-39(54)27-7-1-25(2-8-27)5-12-30(52)24-36(35-21-11-29(50)23-37(35)51)41(56,57)38(53)22-6-26-3-9-28(10-4-26)40(55)59-32-15-19-34(20-16-32)61-43(47,48)49/h1-23,36,56-57H,24,50-51H2/b12-5+,22-6+ |
| InChIKey | NTINARPIAJNGKV-SNEJGAOLSA-N |
| XLogP | 7.81 |
| TPSA | 197.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.72 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|