C24H33N5O4 — CID 87168731
tert-butyl 2-[4-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)butylamino]-2-methylpropanoate (PubChem CID 87168731) has the molecular formula C24H33N5O4 and a molecular weight of 455.56 g/mol. Its IUPAC name is tert-butyl 2-[4-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)butylamino]-2-methylpropanoate.
| Compound Name | tert-butyl 2-[4-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)butylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 87168731 |
| Molecular Formula | C24H33N5O4 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | tert-butyl 2-[4-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)butylamino]-2-methylpropanoate |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CCCCNC(C)(C)C(=O)OC(C)(C)C)c2cc1C |
| InChI | InChI=1S/C24H33N5O4/c1-14-12-16-17(13-15(14)2)29(19-18(26-16)20(30)28-22(32)27-19)11-9-8-10-25-24(6,7)21(31)33-23(3,4)5/h12-13,25H,8-11H2,1-7H3,(H,28,30,32) |
| InChIKey | CHMNMJODURTUHS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|