About 7-oxido-3,7-dihydropurin-7-ium-6-thione
7-oxido-3,7-dihydropurin-7-ium-6-thione (PubChem CID 87168921) has the molecular formula C5H4N4OS
and a molecular weight of 168.18 g/mol. Its IUPAC name is 7-oxido-3,7-dihydropurin-7-ium-6-thione.
Molecular Properties
| Compound Name | 7-oxido-3,7-dihydropurin-7-ium-6-thione |
| PubChem CID | 87168921 |
| Molecular Formula | C5H4N4OS |
| Molecular Weight | 168.18 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | 7-oxido-3,7-dihydropurin-7-ium-6-thione |
| SMILES | [O-][NH+]1C=Nc2[nH]cnc(=S)c21 |
| InChI | InChI=1S/C5H4N4OS/c10-9-2-8-4-3(9)5(11)7-1-6-4/h1-2,9H,(H,6,7,11) |
| InChIKey | DMTXXHSNAAXHCE-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.18 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 7-oxido-3,7-dihydropurin-7-ium-6-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-oxido-3,7-dihydropurin-7-ium-6-thione?
The IUPAC name of 7-oxido-3,7-dihydropurin-7-ium-6-thione (CID 87168921) is 7-oxido-3,7-dihydropurin-7-ium-6-thione.
What is the SMILES notation for 7-oxido-3,7-dihydropurin-7-ium-6-thione?
The canonical SMILES for 7-oxido-3,7-dihydropurin-7-ium-6-thione is [O-][NH+]1C=Nc2[nH]cnc(=S)c21.
What is the InChIKey of 7-oxido-3,7-dihydropurin-7-ium-6-thione?
The InChIKey is DMTXXHSNAAXHCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4OS/c10-9-2-8-4-3(9)5(11)7-1-6-4/h1-2,9H,(H,6,7,11).
What are the key properties of 7-oxido-3,7-dihydropurin-7-ium-6-thione?
7-oxido-3,7-dihydropurin-7-ium-6-thione has a molecular weight of 168.18 g/mol, XLogP of -0.17, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxido-3,7-dihydropurin-7-ium-6-thione is sourced from PubChem (CID 87168921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).