C20H32O2 — CID 87169566
(1S,3R,4R,8R,11S,12R)-8,12,15,15-tetramethyl-5-oxotricyclo[9.3.1.03,8]pentadecane-4-carbaldehyde (PubChem CID 87169566) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1S,3R,4R,8R,11S,12R)-8,12,15,15-tetramethyl-5-oxotricyclo[9.3.1.03,8]pentadecane-4-carbaldehyde.
| Compound Name | (1S,3R,4R,8R,11S,12R)-8,12,15,15-tetramethyl-5-oxotricyclo[9.3.1.03,8]pentadecane-4-carbaldehyde |
|---|---|
| PubChem CID | 87169566 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1S,3R,4R,8R,11S,12R)-8,12,15,15-tetramethyl-5-oxotricyclo[9.3.1.03,8]pentadecane-4-carbaldehyde |
| SMILES | C[C@@H]1CC[C@H]2C[C@@H]3[C@H](C=O)C(=O)CC[C@@]3(C)CC[C@@H]1C2(C)C |
| InChI | InChI=1S/C20H32O2/c1-13-5-6-14-11-17-15(12-21)18(22)8-10-20(17,4)9-7-16(13)19(14,2)3/h12-17H,5-11H2,1-4H3/t13-,14+,15+,16+,17-,20-/m1/s1 |
| InChIKey | GWCYKYWVWMJGSW-SPABQMGBSA-N |
| XLogP | 4.66 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|