About 5-[[2-(4-chlorophenyl)-3-phenyloxiran-2-yl]methyl]-1H-1,2,4-triazole
5-[[2-(4-chlorophenyl)-3-phenyloxiran-2-yl]methyl]-1H-1,2,4-triazole (PubChem CID 87169879) has the molecular formula C17H14ClN3O
and a molecular weight of 311.77 g/mol. Its IUPAC name is 5-[[2-(4-chlorophenyl)-3-phenyloxiran-2-yl]methyl]-1H-1,2,4-triazole.
Molecular Properties
| Compound Name | 5-[[2-(4-chlorophenyl)-3-phenyloxiran-2-yl]methyl]-1H-1,2,4-triazole |
| PubChem CID | 87169879 |
| Molecular Formula | C17H14ClN3O |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 5-[[2-(4-chlorophenyl)-3-phenyloxiran-2-yl]methyl]-1H-1,2,4-triazole |
| SMILES | Clc1ccc(C2(Cc3ncn[nH]3)OC2c2ccccc2)cc1 |
| InChI | InChI=1S/C17H14ClN3O/c18-14-8-6-13(7-9-14)17(10-15-19-11-20-21-15)16(22-17)12-4-2-1-3-5-12/h1-9,11,16H,10H2,(H,19,20,21) |
| InChIKey | HYUZFKOPJFPZCE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 54.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 5-[[2-(4-chlorophenyl)-3-phenyloxiran-2-yl]methyl]-1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[2-(4-chlorophenyl)-3-phenyloxiran-2-yl]methyl]-1H-1,2,4-triazole?
The IUPAC name of 5-[[2-(4-chlorophenyl)-3-phenyloxiran-2-yl]methyl]-1H-1,2,4-triazole (CID 87169879) is 5-[[2-(4-chlorophenyl)-3-phenyloxiran-2-yl]methyl]-1H-1,2,4-triazole.
What is the SMILES notation for 5-[[2-(4-chlorophenyl)-3-phenyloxiran-2-yl]methyl]-1H-1,2,4-triazole?
The canonical SMILES for 5-[[2-(4-chlorophenyl)-3-phenyloxiran-2-yl]methyl]-1H-1,2,4-triazole is Clc1ccc(C2(Cc3ncn[nH]3)OC2c2ccccc2)cc1.
What is the InChIKey of 5-[[2-(4-chlorophenyl)-3-phenyloxiran-2-yl]methyl]-1H-1,2,4-triazole?
The InChIKey is HYUZFKOPJFPZCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14ClN3O/c18-14-8-6-13(7-9-14)17(10-15-19-11-20-21-15)16(22-17)12-4-2-1-3-5-12/h1-9,11,16H,10H2,(H,19,20,21).
What are the key properties of 5-[[2-(4-chlorophenyl)-3-phenyloxiran-2-yl]methyl]-1H-1,2,4-triazole?
5-[[2-(4-chlorophenyl)-3-phenyloxiran-2-yl]methyl]-1H-1,2,4-triazole has a molecular weight of 311.77 g/mol, XLogP of 3.67, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[2-(4-chlorophenyl)-3-phenyloxiran-2-yl]methyl]-1H-1,2,4-triazole is sourced from PubChem (CID 87169879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).