About (4-fluoro-2-hydroxy-3,3-dimethylbutyl)-trimethylazanium
(4-fluoro-2-hydroxy-3,3-dimethylbutyl)-trimethylazanium (PubChem CID 87169933) has the molecular formula C9H21FNO+
and a molecular weight of 178.27 g/mol. Its IUPAC name is (4-fluoro-2-hydroxy-3,3-dimethylbutyl)-trimethylazanium.
Molecular Properties
| Compound Name | (4-fluoro-2-hydroxy-3,3-dimethylbutyl)-trimethylazanium |
| PubChem CID | 87169933 |
| Molecular Formula | C9H21FNO+ |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.16 |
| IUPAC Name | (4-fluoro-2-hydroxy-3,3-dimethylbutyl)-trimethylazanium |
| SMILES | CC(C)(CF)C(O)C[N+](C)(C)C |
| InChI | InChI=1S/C9H21FNO/c1-9(2,7-10)8(12)6-11(3,4)5/h8,12H,6-7H2,1-5H3/q+1 |
| InChIKey | TXRCSUQIVSPVRH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (4-fluoro-2-hydroxy-3,3-dimethylbutyl)-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluoro-2-hydroxy-3,3-dimethylbutyl)-trimethylazanium?
The IUPAC name of (4-fluoro-2-hydroxy-3,3-dimethylbutyl)-trimethylazanium (CID 87169933) is (4-fluoro-2-hydroxy-3,3-dimethylbutyl)-trimethylazanium.
What is the SMILES notation for (4-fluoro-2-hydroxy-3,3-dimethylbutyl)-trimethylazanium?
The canonical SMILES for (4-fluoro-2-hydroxy-3,3-dimethylbutyl)-trimethylazanium is CC(C)(CF)C(O)C[N+](C)(C)C.
What is the InChIKey of (4-fluoro-2-hydroxy-3,3-dimethylbutyl)-trimethylazanium?
The InChIKey is TXRCSUQIVSPVRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21FNO/c1-9(2,7-10)8(12)6-11(3,4)5/h8,12H,6-7H2,1-5H3/q+1.
What are the key properties of (4-fluoro-2-hydroxy-3,3-dimethylbutyl)-trimethylazanium?
(4-fluoro-2-hydroxy-3,3-dimethylbutyl)-trimethylazanium has a molecular weight of 178.27 g/mol, XLogP of 1.05, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluoro-2-hydroxy-3,3-dimethylbutyl)-trimethylazanium is sourced from PubChem (CID 87169933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).