C12H16N2O7 — CID 87169976
1-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(3-methoxy-2-methyloxiran-2-yl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 87169976) has the molecular formula C12H16N2O7 and a molecular weight of 300.27 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(3-methoxy-2-methyloxiran-2-yl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(3-methoxy-2-methyloxiran-2-yl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 87169976 |
| Molecular Formula | C12H16N2O7 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 1-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(3-methoxy-2-methyloxiran-2-yl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | COC1OC1(C)[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H16N2O7/c1-12(10(19-2)21-12)8-6(16)7(17)9(20-8)14-4-3-5(15)13-11(14)18/h3-4,6-10,16-17H,1-2H3,(H,13,15,18)/t6-,7+,8-,9+,10?,12?/m0/s1 |
| InChIKey | ZBRADZHISICPGT-OYEQKBJRSA-N |
| XLogP | -2.08 |
| TPSA | 126.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|