C18H36O5 — CID 87170012
1,1-diethoxyethane;3,7-dimethylocta-2,6-dienal;ethane-1,2-diol (PubChem CID 87170012) has the molecular formula C18H36O5 and a molecular weight of 332.48 g/mol. Its IUPAC name is 1,1-diethoxyethane;3,7-dimethylocta-2,6-dienal;ethane-1,2-diol.
| Compound Name | 1,1-diethoxyethane;3,7-dimethylocta-2,6-dienal;ethane-1,2-diol |
|---|---|
| PubChem CID | 87170012 |
| Molecular Formula | C18H36O5 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | 1,1-diethoxyethane;3,7-dimethylocta-2,6-dienal;ethane-1,2-diol |
| SMILES | CC(C)=CCCC(C)=CC=O.CCOC(C)OCC.OCCO |
| InChI | InChI=1S/C10H16O.C6H14O2.C2H6O2/c1-9(2)5-4-6-10(3)7-8-11;1-4-7-6(3)8-5-2;3-1-2-4/h5,7-8H,4,6H2,1-3H3;6H,4-5H2,1-3H3;3-4H,1-2H2 |
| InChIKey | BFDUTFAROUMXHF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|