C30H32ClFN3O4+ — CID 87170474
(6-carboxyoxy-3,3-dimethyl-1,2-dihydroinden-1-yl)-(2-chloro-5-fluorobenzoyl)-methyl-(1-pyridin-4-ylpiperidin-4-yl)azanium (PubChem CID 87170474) has the molecular formula C30H32ClFN3O4+ and a molecular weight of 553.05 g/mol. Its IUPAC name is (6-carboxyoxy-3,3-dimethyl-1,2-dihydroinden-1-yl)-(2-chloro-5-fluorobenzoyl)-methyl-(1-pyridin-4-ylpiperidin-4-yl)azanium.
| Compound Name | (6-carboxyoxy-3,3-dimethyl-1,2-dihydroinden-1-yl)-(2-chloro-5-fluorobenzoyl)-methyl-(1-pyridin-4-ylpiperidin-4-yl)azanium |
|---|---|
| PubChem CID | 87170474 |
| Molecular Formula | C30H32ClFN3O4+ |
| Molecular Weight | 553.05 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | (6-carboxyoxy-3,3-dimethyl-1,2-dihydroinden-1-yl)-(2-chloro-5-fluorobenzoyl)-methyl-(1-pyridin-4-ylpiperidin-4-yl)azanium |
| SMILES | CC1(C)CC([N+](C)(C(=O)c2cc(F)ccc2Cl)C2CCN(c3ccncc3)CC2)c2cc(OC(=O)O)ccc21 |
| InChI | InChI=1S/C30H31ClFN3O4/c1-30(2)18-27(23-17-22(39-29(37)38)5-6-25(23)30)35(3,28(36)24-16-19(32)4-7-26(24)31)21-10-14-34(15-11-21)20-8-12-33-13-9-20/h4-9,12-13,16-17,21,27H,10-11,14-15,18H2,1-3H3/p+1 |
| InChIKey | SZINQGVIQDRNCY-UHFFFAOYSA-O |
| XLogP | 6.61 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.05 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|